Կազեին

Վիքիպեդիայից՝ ազատ հանրագիտարանից
Կազեին
Քիմիական բանաձև C₈₁H₁₂₅N₂₂O₃₉P
Մոլային զանգված 2 060,821189 զանգվածի ատոմական միավոր[1] գ/մոլ
Քիմիական հատկություններ
Դասակարգում
CAS համար 9000-71-9
PubChem 73995022
EINECS համար 232-555-1
SMILES CC(C)CC(C(=NC(CCC(=N)O)C(=NC(CC(=O)O)C(=NC(CCCCN)C(=O)O)O)O)O)N=C(C(CCC(=O)O)N=C(C(CC(=O)O)N=C(C(CCC(=O)O)N=C(C(C(C)O)N=C(C(CCC(=N)O)N=C(C(CCC(=N)O)N=C(C(CCC(=N)O)N=C(C(CCC(=O)O)N=C(C(CCC(=O)O)N=C(C(COP(=O)(O)O)N=C(C(CCC(=N)O)N=C(C(CC1=CC=CC=C1)N)O)O)O)O)O)O)O)O)O)O)O)O
ЕС 232-555-1
ChEBI 29272861
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Կազեինը (լատ.՝ caseus - պանիր բառից) կաթի մեջի սպիտակուցային նյութ է, որը կովի կաթի և պանրի սպիտակուցի մոտ 80%-ն է կազմում։

Կազեինը հեշտությանբ կարելի է անջատել հեղուկից, եթե երեսը քաշած կաթին ավելացվի մի փոքր թթու, օրինակ՝ քացախաթթու, այդ ժամանակ կազեինը կմակարդվի[2]։

Կազեինը լոռի ու պանրի գլխավոր բաղադրիչ մասն է կազմում[2]։

Բնակչության փոքր տոկոսը ալերգիա ունի կազեինի նկատմամբ[3]։

Ծանոթագրություններ[խմբագրել | խմբագրել կոդը]

  1. 1,0 1,1 9000-71-9
  2. 2,0 2,1 Յու․ Վ․ Խոդակով, Լ․ Ա․ Ցվետկով և ուրիշներ։ «Քիմիա», Երևան, 1961։
  3. http://www3.interscience.wiley.com/journal/119209344/abstract