Քինին

Վիքիպեդիայից՝ ազատ հանրագիտարանից
Քինին
Chinin.svg
Քիմիական բանաձև C₂₀H₂₄N₂O₂
Մոլային զանգված 324,184 զանգվածի ատոմական միավոր[1] գ/մոլ
Հալման ջերմաստիճան 177 °C °C
Քիմիական հատկություններ
Դասակարգում
CAS համար 130-95-0
PubChem 3034034
EINECS համար 205-003-2
SMILES COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O
ЕС 205-003-2
ChEBI 84989
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)
Quinine-3D-balls.png

Քինին, ալկալոիդ, պարունակվում է քինածառի կեղևում։ Մաքուր վիճակում առաջին անգամ անջատել են 1820-ին՝ ֆրանսիացի քիմիկոսներ Պիեռ Ժոզեֆ Պելետիեն և Ժոզեֆ Բիենեմե Կավանտուն։ 1944-ին ամերիկացի քիմիկոսներ Ռոբերտ Վուդվորդը և Վիլյամ Դերինգը իրականացրին քինինի լրիվ սինթեզը։

Քիմիական կառուցվածքով քինինը բարդ բազմացիկլիկ միացություն է։ Հիմք է, վատ է լուծվում ջրում, լավ՝ սպիրտում, եթերում, քլորոֆորմում։ Բուժիչ դեղաչափերով ազդում է օրգանիզմի տարբեր համակարգերի վրա. ընկճում է ջերմակարգավորման կենտրոնները, իջեցնում սրտամկանի դրդողականությունը, նվազեցնում կծկողունակությունը, դրդում է արգանդի մկանունքը և ուժեղացնում կծկումները։

Քինինը հակամալարիային դեղամիջոց է։ Թունավոր դեղաչափերով քինինը ճնշում է գլխուղեղի կեղևի գործունեությունը, առաջացնում շշմածություն, գլխապտույտ, փսխումներ և թունավորման այլ ախտանշաններ։

Ծանոթագրություններ[խմբագրել | խմբագրել կոդը]

  1. 1,0 1,1 Quinine
Այս հոդվածի կամ նրա բաժնի որոշակի հատվածի սկզբնական կամ ներկայիս տարբերակը վերցված է Քրիեյթիվ Քոմմոնս Նշում–Համանման տարածում 3.0 (Creative Commons BY-SA 3.0) ազատ թույլատրագրով թողարկված Հայկական սովետական հանրագիտարանից։ CC-BY-SA-icon-80x15.png