Տետրոդոտոքսին

Վիքիպեդիայից՝ ազատ հանրագիտարանից
Տետրոդոտոքսին
Tetrodotoxin-2D-skeletal.png
Քիմիական բանաձև C₁₁H₁₇N₃O₈
Մոլային զանգված 319,101565 զանգվածի ատոմական միավոր[1] գ/մոլ
Հալման ջերմաստիճան 225 °C °C
Քիմիական հատկություններ
Դասակարգում
CAS համար 4368-28-9
PubChem 20382
EINECS համար 224-458-8
SMILES C(C1(C2C3C(N=C(NC34C(C1OC(C4O)(O2)O)O)N)O)O)O
ЕС 224-458-8
RTECS IO1450000
ChEBI 21248349
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Տետրոդոտոքսին - ամենաթունավոր նյութն է (կուրարեանման) բնական ծագման, որի ամենամեծ կոնցենտրացիան ֆուգու ձկան մեջ է (լյարդ

Պատմություն[խմբագրել | խմբագրել կոդը]

Հայտի է որ, դեռ շատ վաղուց հին ցեղերի վհուկներին հայտնի է եղել ֆուգու ձկան մասին։ Նրանք աղացել են ձուկը և ստացել տետրոդոտոքսինով հարուստ այսպես կոչված զոմբի փոշին, որը տալով անսանձ բնակիչներին, նրան հասցրել են մի երրորդ հոմեոստազի վիճակի, որը կոչվում է Պորտալ սիրտ, այնուհետև նրան արթնացնելով հայտարարել են, որ խնդրեցին աստվածներին ու կյանքի կոչեցին նրան, մյուս անգամ աստվածները էլ չեն գթա։

Ազդեցության մեխանիզմը[խմբագրել | խմբագրել կոդը]

Մեզ հայտնի է նյարդաթելով գրգռի անցման մեխանիզմը։ Տետրոդոտոքսինի բաղադրության մեջ մտնում է գուանիդինային խումբը, որը իր ֆիզիկաքիմիական հատկություններով շատ նման է նատրիումական իոններին, և գործողության պոտենցիալի ժամանակ նա խցանի պես փակում է նատրիումական անցուղիները, որով և խաթարում է գրգռափոխանցումը։ Այսպիսով մարդը որոշակի քանակի տետրադոտոքսին ստանալու դեպքում ընկնում է այլ հոմեոստատիկ վիճակի մեջ։

Օգտագործումը բժշկության մեջ[խմբագրել | խմբագրել կոդը]

Այս թույնով պատրաստված պրեպարատները կարելի է օգտագործել թմրամոլությունը բուժելու գործում, որովհետև նա չի առաջացնում ֆիզիկական կախվածություն և հիվանդին հնարավորություն է տալիս դիմանալու ժուշկալման սինդրոմին մինչև էնդորֆինների սինթեզի վերականգնումը, որը տևում է մոտ 2 շաբաթ։

Ծանոթագրություններ[խմբագրել | խմբագրել կոդը]

  1. 1,0 1,1 Spheroidine