Պանտոտենաթթու

Վիքիպեդիայից՝ ազատ հանրագիտարանից
Պանտոտենաթթու
Քիմիական բանաձև C₉H₁₇NO₅
Մոլային զանգված 219,110673 զանգվածի ատոմական միավոր[1] գ/մոլ
Հալման ջերմաստիճան 18 383 °C °C
Քիմիական հատկություններ
Դասակարգում
CAS համար 599-54-2
PubChem 988
EINECS համար 209-965-4
SMILES CC(C)(CO)C(C(=O)NCCC(=O)O)O
ЕС 209-965-4
ChEBI 963
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Պանտոտենաթթու (վիտամին В3), հակամաշկաբորբային գործոն, ջրալույծ վիտամին։ Քիմյական բնույթով երկպեպտիդ Է՝ կազմված ß-ալանինի և պանտոյաթթվի մնացորդներից։ Մտնում է նյութափոխանակության կարևոր ռեակցիաներին մասնակցող A-կոֆերմենտի բաղադրության մեջ։ Մարդու օրական պահանջը 5—10 մգ Է։ Պանտոտենաթթու պարունակվում է խմորասնկերում, ձկնկիթում, ձվի դեղնուցում, կաթի, գազարի, կաղամբի Վուն մեջ։ Պանտոտենաթթուի անբավարարությունից առաջանում են մաշկաբորբեր, խանգարվում է նյութափոխանակությունը, որի հետևանքով թափվում են մազերը, բուրդը, փետուրները, դադարում է օրգանիզմի աճումը, խանգարվում է սրտի, ստամոքսի, երիկամների ֆունկցիան։ Բժշկության մեջ օգտագործվում է ստամոքսաաղիքային վիրահատոլ- թյուններից հետո աղիքների տոնուսը վերականգնելու համար։

Ծանոթագրություններ[խմբագրել | խմբագրել կոդը]

  1. 1,0 1,1 D-pantothenic acid
Այս հոդվածի կամ նրա բաժնի որոշակի հատվածի սկզբնական կամ ներկայիս տարբերակը վերցված է Քրիեյթիվ Քոմմոնս Նշում–Համանման տարածում 3.0 (Creative Commons BY-SA 3.0) ազատ թույլատրագրով թողարկված Հայկական սովետական հանրագիտարանից։ CC-BY-SA-icon-80x15.png