Ֆթալաթթու

Վիքիպեդիայից՝ ազատ հանրագիտարանից
(Վերահղված է Ֆթալաթթուներից)
Ֆթալաթթու
Phthalic acid 200.svg
Phthalic acid.JPG
Քիմիական բանաձև C₈H₆O₄
Մոլային զանգված 166,027 զանգվածի ատոմական միավոր[1] գ/մոլ
Քիմիական հատկություններ
Դասակարգում
CAS համար 88-99-3
PubChem 1017
EINECS համար 201-873-2
SMILES C1=CC=C(C(=C1)C(=O)O)C(=O)O
ЕС 201-873-2
ChEBI 992
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Ֆթալաթթուներ, բենզոլերկ-կարբոնաթթուներ, արոմատիկ երկկարբոնաթթուներ՝ С6Н4 (СОOH)2։

Հայտնի են օրթո- (կամ պարզապես ֆթալաթթու), մետա- (իզոֆթալաթթու) և պարա- (տերեֆթաալաթթու) ֆթալաթթուներ։ Անգույն բյուրեղներ են, հալվում են համապատասխանաբար՝ 200 (քայքայումով), 348 և 425 °C-ում (փակ մազանոթում)։

Ֆթալաթթուներն ստացվում է կատալիզատորների ներկայությամբ՝ ծխացող H2ՏՕ4-ով կամ օդի Օ2-ով նավթալինի օքսիդացմամբ։ Աղերն ու եթերները կոչվում են ֆթալատներ։ Կիրառական նշանակություն ունեն С6Н4 (СОOH)2 տիպի էսթերները, որոնք դժվարաեռ հեղուկներ են, օգտագործվում են որպես պոլիմերների պլաստիֆիկատորներ, մանոմետրի հեղուկ, որոշները՝ ներկանյութերի արտադրության մեջ։

Կիրառվում են օրթո-ֆթալաթթուների պոլիէսթերային, օրինակ, գլիֆթալային (գլիցերինի հետ) և պենտաֆթալային (պենտաէրիտրիտի հետ) խեժերը։ Իզոֆթալաթթվի աղերն ու եթերները կոչվում են իզոֆթալատներ։

Ծանոթագրություններ[խմբագրել | խմբագրել կոդը]

  1. 1,0 1,1 phthalic acid
Այս հոդվածի կամ նրա բաժնի որոշակի հատվածի սկզբնական կամ ներկայիս տարբերակը վերցված է Քրիեյթիվ Քոմմոնս Նշում–Համանման տարածում 3.0 (Creative Commons BY-SA 3.0) ազատ թույլատրագրով թողարկված Հայկական սովետական հանրագիտարանից։ CC-BY-SA-icon-80x15.png