Սերոտոնին

Վիքիպեդիայից՝ ազատ հանրագիտարանից
Սերոտոնին
Serotonin-skeletal.png
Քիմիական բանաձև C₁₀H₁₂N₂O
Մոլային զանգված 176,095 զանգվածի ատոմական միավոր[1] գ/մոլ
Հալման ջերմաստիճան 167,5 °C °C
Եռման ջերմաստիճան 416±30 °C °C
Քիմիական հատկություններ
pKa 10,4
Դիպոլ մոմենտ 2,98 դեբայ
Դասակարգում
CAS համար 50-67-9
PubChem 5202
EINECS համար 200-058-9
SMILES C1=CC2=C(C=C1O)C(=CN2)CCN
ЕС 200-058-9
ChEBI 5013
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)
Սերոտոնին

Սերոտոնինը պատկանում է մարդու օրգանիզմի կենսաբանական ակտիվ նյութերի թվին, արտադրվում է գլխուղեղի կողմից և հանդիսանում է կենտրոնական նյարդային համակարգի ակտիվ գործունեության խթանիչ։ Այն արթնացնում ու պահում է մարդկանց մեջ ապրելու զգացումը, ինչպես նաև՝ ակտիվ կենսակերպ վարելու, ամբողջ եռանդով աշխատանքին նվիրվելու, շփվելու, սիրելու և այլ ձգտումները։

Կանանց մոտ սերոտոնինն ավելի քիչ է արտադրվում, քան՝ տղամարդկանց։ Այդ իսկ պատճառով էլ կանայք ավելի պասիվ են և ավելի քիչ ինքնավստահ։ Եվ հենց նույն պատճառով էլ կանայք ավելի հաճախ են տագնապում, տխրում, միայնակության զգացում ապրում, տանջվում մեղքի զգացողությունից և այլն։ Նույն պատճառով էլ աշնանային սեզոնային փոփոխությունների ազդեցությանն ավելի հակված են կանայք։

Ծանոթագրություններ[խմբագրել | խմբագրել կոդը]

  1. 1,0 1,1 serotonin