Ուրիդին

Վիքիպեդիայից՝ ազատ հանրագիտարանից
Ուրիդին
Uridin.svg
Քիմիական բանաձև C₉H₁₂N₂O₆
Մոլային զանգված 244,07 զանգվածի ատոմական միավոր[1] գ/մոլ
Քիմիական հատկություններ
Դասակարգում
CAS համար 58-96-8
PubChem 6029
EINECS համար 200-407-5
SMILES C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O
ЕС 200-407-5
ChEBI 5807
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Ուրիդին, ուրացիլռիբոզիդ, օրգանական նյութ, նուկլեոզիդ է, կազմված պիրիմիդինային հիմք ուրացիլի և ռիբոզ ածխաջրի միացությունից։ Մաքուր վիճակում սպիտակ փոշի Է։ Լինում է նաև երկար, ասեղնաձև կամ բազմանիստ բյուրեղների ձևով։ Լուծվում է ջրում, թթուներում, հիմքերում, չի լուծվում եթերներում, խիտ էթանոլում։ Մոլային զանգվածը 244,2 է։ Պարունակվում է բոլոր բջիջների ռիբոնուկլեինաթթուներում։ Բազմաթիվ կոֆերմենտների կազմում կարևոր դեր է կատարում ածխաջրերի փոխանակության պրոցեսներում։

Ծանոթագրություններ[խմբագրել | խմբագրել կոդը]

  1. 1,0 1,1 uridine
Այս հոդվածի կամ նրա բաժնի որոշակի հատվածի սկզբնական կամ ներկայիս տարբերակը վերցված է Քրիեյթիվ Քոմմոնս Նշում–Համանման տարածում 3.0 (Creative Commons BY-SA 3.0) ազատ թույլատրագրով թողարկված Հայկական սովետական հանրագիտարանից։ CC-BY-SA-icon-80x15.png