Կոֆեին

Վիքիպեդիայից՝ ազատ հանրագիտարանից
Կոֆեին
Koffein - Caffeine.svg
Քիմիական բանաձև C₈H₁₀N₄O₂
Մոլային զանգված 194,08 զանգվածի ատոմական միավոր[1] գ/մոլ
Խտություն 1,23 գ/սմ³ գ/սմ³
Հալման ջերմաստիճան 234 °C °C
Սուբլիմացման ջերմաստիճան 180 °C
Քիմիական հատկություններ
pKa 14 և 10,4[2]
Դիպոլ մոմենտ 3,64 դեբայ
Դասակարգում
CAS համար 58-08-2
PubChem 2519
EINECS համար 200-362-1
SMILES CN1C=NC2=C1C(=O)N(C(=O)N2C)C
ЕС 200-362-1
RTECS EV6475000
ChEBI 2424
Եթե հատուկ նշված չէ, ապա բոլոր արժեքները բերված են ստանդարտ պայմանների համար (25 °C, 100 կՊա)

Կոֆեին, կենտրոնական նյարդային համակարգի գործունեությունը խթանող դեղամիջոց. տրիմեթիլքսանտին-ալկալոիդ է, պարունակվում է թեյի տերևներում, սուրճի սերմերում, կոլա ընկույզում։ Ստացվում է նաև սինթետիկ ճանապարհով։ Օգտագործվում է ներքին ընդունման համար, հաբերով՝ կենտրոնական նյարդային համակարգի ընկճվածության, սրտի գործունեության թուլության, թմրանյութերով թունավորման, հիպոտոնիայի, անգարի (միգրեն) և այլ դեպքերում։ Ենթամաշկային ճանապարհով ներարկում են կոֆեին նատրիումի բենզոատ լուծույթ (38% մաքուր կոֆեինի պարունակությամբ)։

Այս հոդվածի կամ նրա բաժնի որոշակի հատվածի սկզբնական կամ ներկայիս տարբերակը վերցված է Քրիեյթիվ Քոմմոնս Նշում–Համանման տարածում 3.0 (Creative Commons BY-SA 3.0) ազատ թույլատրագրով թողարկված Հայկական սովետական հանրագիտարանից  (հ․ 5, էջ 665 CC-BY-SA-icon-80x15.png


  1. 1,0 1,1 caffeine
  2. Lange N. A., Dean J. A. Lange's Handbook of chemistry — 1985.